For research use only. Not for therapeutic Use.
Fmoc-leucine-d3（Cat No.:I043945）is a stable, isotopically labeled derivative of leucine, featuring an Fmoc (fluorenylmethyloxycarbonyl) protective group, primarily utilized in peptide synthesis and quantitative proteomics. The incorporation of three deuterium atoms enhances accuracy in mass spectrometry-based analyses by serving as an internal standard, significantly reducing experimental variability. Widely employed in biochemical and pharmacological studies, Fmoc-leucine-d3 facilitates precise measurement of peptide abundance, reaction efficiencies, and metabolic pathways. Its high isotopic purity and stability make it indispensable for researchers seeking reliable, quantitative insights into protein synthesis, structure determination, and metabolic dynamics.
| CAS Number | 538372-74-6 |
| Synonyms | (2S)-5,5,5-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid |
| Molecular Formula | C21H20D3NO4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-5,5,5-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid |
| InChI | InChI=1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m0/s1/i1D3/t13?,19- |
| InChIKey | CBPJQFCAFFNICX-VWCYLIGHSA-N |
| SMILES | [2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
