For research use only. Not for therapeutic Use.
Farrerol（Cat No.:R036610）is a natural flavanone isolated from Rhododendron species, valued for its broad pharmacological activities. It demonstrates strong anti-inflammatory, antioxidant, antibacterial, and anticancer effects. Mechanistic studies show that Farrerol inhibits pro-inflammatory mediators like TNF-α, IL-6, and COX-2, while modulating NF-κB and MAPK signaling pathways. Its antioxidant capacity protects against oxidative stress-related cellular damage, and it exhibits cytotoxicity against certain cancer cell lines. Farrerol also shows promise in cardiovascular and metabolic disease research. With multifunctional bioactivity, it represents a potential therapeutic candidate for diverse biomedical applications.
| CAS Number | 24211-30-1 |
| Synonyms | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one |
| Molecular Formula | C17H16O5 |
| Purity | ≥95% |
| IUPAC Name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethyl-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C17H16O5/c1-8-15(20)9(2)17-14(16(8)21)12(19)7-13(22-17)10-3-5-11(18)6-4-10/h3-6,13,18,20-21H,7H2,1-2H3/t13-/m0/s1 |
| InChIKey | DYHOLQACRGJEHX-ZDUSSCGKSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)C[C@H](O2)C3=CC=C(C=C3)O)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
