For research use only. Not for therapeutic Use.
Factor D inhibitor 6（Cat No.:I014999）is a small-molecule compound that selectively blocks complement factor D, a serine protease essential for activation of the alternative complement pathway. By inhibiting factor D, it prevents the cleavage of factor B and formation of the C3 convertase, thereby suppressing downstream complement activation. This makes Factor D inhibitor 6 a valuable research tool for studying immune regulation, inflammation, and complement-driven disorders. It is investigated in therapeutic contexts such as paroxysmal nocturnal hemoglobinuria (PNH), age-related macular degeneration (AMD), and other complement-mediated diseases.
| CAS Number | 1386455-51-1 |
| Synonyms | 1-[2-[(1R,3S,5R)-3-[[(1R)-1-(3-chloro-2-fluorophenyl)ethyl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]pyrazolo[3,4-c]pyridine-3-carboxamide |
| Molecular Formula | C23H22ClFN6O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[2-[(1R,3S,5R)-3-[[(1R)-1-(3-chloro-2-fluorophenyl)ethyl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]pyrazolo[3,4-c]pyridine-3-carboxamide |
| InChI | InChI=1S/C23H22ClFN6O3/c1-11(13-3-2-4-15(24)20(13)25)28-23(34)17-8-12-7-16(12)31(17)19(32)10-30-18-9-27-6-5-14(18)21(29-30)22(26)33/h2-6,9,11-12,16-17H,7-8,10H2,1H3,(H2,26,33)(H,28,34)/t11-,12-,16-,17+/m1/s1 |
| InChIKey | YAALCKJNOOFODD-SKNMWMDOSA-N |
| SMILES | C[C@H](C1=C(C(=CC=C1)Cl)F)NC(=O)[C@@H]2C[C@H]3C[C@H]3N2C(=O)CN4C5=C(C=CN=C5)C(=N4)C(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
