For research use only. Not for therapeutic Use.
EXP3179（Cat No.:R004333）is a non-hypotensive metabolite of the angiotensin II type 1 receptor blocker (ARB) losartan, known for its potent anti-inflammatory and anti-fibrotic properties. Unlike losartan, EXP3179 does not significantly affect blood pressure but exerts therapeutic effects by inhibiting NADPH oxidase activity and reducing oxidative stress. It also downregulates pro-inflammatory cytokines and fibrotic markers, making it valuable for research in cardiovascular, renal, and metabolic disorders. EXP3179 is particularly useful in exploring the mechanisms of organ protection beyond blood pressure control, highlighting its potential in treating fibrosis and chronic inflammation.
| CAS Number | 114798-36-6 |
| Synonyms | 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde |
| Molecular Formula | C22H21ClN6O |
| Purity | ≥95% |
| IUPAC Name | 2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde |
| InChI | InChI=1S/C22H21ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,14H,2-3,8,13H2,1H3,(H,25,26,27,28) |
| InChIKey | FQZSMTSTFMNWQF-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)C=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
