For research use only. Not for therapeutic Use.
Exarafenib（Cat No.:I043409）is a novel dual-targeted inhibitor primarily designed to block both BRAF and EGFR signaling pathways. It shows potential in treating various cancers, particularly those with mutations in the BRAF gene, such as melanoma, colorectal, and non-small cell lung cancer. By inhibiting these pathways, Exarafenib may reduce tumor growth and enhance the efficacy of other cancer therapies. Currently undergoing clinical trials, it is being studied for its ability to overcome resistance to traditional BRAF inhibitors and improve outcomes in patients with BRAF-mutant and EGFR-driven cancers.
| CAS Number | 2639957-39-2 |
| Synonyms | (3S)-N-[3-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-6-morpholin-4-ylpyridin-4-yl]-4-methylphenyl]-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide |
| Molecular Formula | C26H34F3N5O3 |
| Purity | ≥95% |
| IUPAC Name | (3S)-N-[3-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-6-morpholin-4-ylpyridin-4-yl]-4-methylphenyl]-3-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide |
| InChI | InChI=1S/C26H34F3N5O3/c1-17-3-4-21(31-25(36)34-6-5-19(15-34)14-26(27,28)29)13-22(17)20-11-23(30-18(2)16-35)32-24(12-20)33-7-9-37-10-8-33/h3-4,11-13,18-19,35H,5-10,14-16H2,1-2H3,(H,30,32)(H,31,36)/t18-,19+/m1/s1 |
| InChIKey | GZMYLSJUNSCMTD-MOPGFXCFSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)N2CC[C@H](C2)CC(F)(F)F)C3=CC(=NC(=C3)N4CCOCC4)N[C@H](C)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
