For research use only. Not for therapeutic Use.
Estradiol Benzoate(CAT: A000964) is a synthetic ester of the natural estrogen 17β-estradiol, featuring a benzoate group at the C3 hydroxyl position. This structural modification enhances its lipophilicity and prolongs its biological half-life, making it suitable for sustained-release hormone therapies. Widely used in endocrinology research, veterinary medicine, and reproductive biology, estradiol benzoate mimics endogenous estrogen activity, influencing gene expression, cell proliferation, and reproductive function. Its extended duration of action makes it valuable for studying estrogen receptor pathways and hormonal regulation in animal models. With high potency and consistent performance, it is a trusted compound for hormonal modulation and endocrine-related investigations.
| CAS Number | 50-50-0 |
| Synonyms | NA |
| Molecular Formula | C25H28O3 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | 3 years -20C powder |
| IUPAC Name | [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| InChI | InChI=1S/C25H28O3/c1-25-14-13-20-19-10-8-18(28-24(27)16-5-3-2-4-6-16)15-17(19)7-9-21(20)22(25)11-12-23(25)26/h2-6,8,10,15,20-23,26H,7,9,11-14H2,1H3/t20-,21-,22+,23+,25+/m1/s1 |
| InChIKey | UYIFTLBWAOGQBI-BZDYCCQFSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)OC(=O)C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
