Eravacycline dihydrochloride - CAS 1334714-66-7
Eravacycline dihydrochloride(CAT: I013150) is a potent and broad-spectrum antibacterial agent. It belongs to the class of tetracycline antibiotics and is specifically designed to overcome resistance mechanisms that can limit the efficacy of other antibiotics. Eravacycline works by inhibiting bacterial protein synthesis, thereby preventing the growth and proliferation of bacteria. It has demonstrated activity against a wide range of Gram-positive and Gram-negative pathogens, including multidrug-resistant strains. Eravacycline dihydrochloride has been investigated for its potential in treating various infections, including complicated intra-abdominal infections and complicated urinary tract infections.
Catalog Number: I013150
CAS Number: 1334714-66-7
PubChem Substance ID:355048094
Molecular Formula: C₂₇H₃₃Cl₂FN₄O₈
Molecular Weight:631.48
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
| Molecular Formula: | C₂₇H₃₃Cl₂FN₄O₈ |
|---|---|
| Molecular Weight | 631.48 |
| Target: | Bacterial |
| Solubility | H2O |
| Purity | ≥95% |
Computed Descriptor
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride |
|---|---|
| InChI | InChI=1S/C27H31FN4O8.2ClH/c1-31(2)20-13-8-11-7-12-14(28)9-15(30-16(33)10-32-5-3-4-6-32)21(34)18(12)22(35)17(11)24(37)27(13,40)25(38)19(23(20)36)26(29)39;;/h9,11,13,20,34-35,38,40H,3-8,10H2,1-2H3,(H2,29,39)(H,30,33);2*1H/t11-,13-,20-,27-;;/m0../s1 |
| InChIKey | XIBSSTYDNTVAEU-RZVFYPHASA-N |
| SMILES | CN(C)C1C2CC3CC4=C(C=C(C(=C4C(=C3C(=O)C2(C(=C(C1=O)C(=O)N)O)O)O)O)NC(=O)CN5CCCC5)F.Cl.Cl |