For research use only. Not for therapeutic Use.
Epiquinidine（Cat No.:R052566）is a stereoisomer of quinidine and belongs to the class Ia antiarrhythmic agents. It functions by blocking sodium channels, thereby prolonging the cardiac action potential and slowing conduction velocity. Though structurally similar to quinidine, epiquinidine exhibits distinct pharmacodynamic properties and is primarily used in research to study stereoisomeric effects on cardiac electrophysiology. Its ability to modulate cardiac rhythm makes it valuable in investigating arrhythmias and drug-receptor interactions. Epiquinidine supports experimental models focused on ion channel behavior and cardiac pharmacology.
| CAS Number | 572-59-8 |
| Synonyms | (R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| Molecular Formula | C20H24N2O2 |
| Purity | ≥95% |
| IUPAC Name | (R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19+,20+/m0/s1 |
| InChIKey | LOUPRKONTZGTKE-AFHBHXEDSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@H]3C[C@@H]4CCN3C[C@@H]4C=C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
