EGFR Inhibitor - CAS 879127-07-8
EGFR Inhibitor(CAT: I011589) is a small molecule drug that targets the Epidermal Growth Factor Receptor (EGFR), a protein that is often overexpressed in various types of cancer. EGFR plays a key role in tumor growth, metastasis, and resistance to chemotherapy, making it an attractive target for cancer therapy. The EGFR inhibitor works by binding to the EGFR tyrosine kinase domain and inhibiting its activity, leading to reduced cell proliferation and increased apoptosis (cell death) in cancer cells. It has been studied for its potential therapeutic applications in various types of cancer, including non-small cell lung cancer, colorectal cancer, and pancreatic cancer. In addition, the EGFR inhibitor has also been investigated for its potential to overcome resistance to other targeted therapies, such as tyrosine kinase inhibitors.
Catalog Number: I011589
CAS Number: 879127-07-8
PubChem Substance ID:355163809
Molecular Formula: C21H18F3N5O
Molecular Weight:413.404
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
Synonyms | N-[3-[[6-[[3-(trifluoromethyl)phenyl]amino]-4-pyrimidinyl]amino]phenyl]-cyclopropanecarboxamide |
---|
Property
Molecular Formula: | C21H18F3N5O |
---|---|
Molecular Weight | 413.404 |
Target: | EGFR |
Solubility | Soluble in DMSO |
Purity | ≥95% |
Storage | Store at -20°C |
Computed Descriptor
IUPAC Name | N-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide |
---|---|
InChI | InChI=1S/C21H18F3N5O/c22-21(23,24)14-3-1-4-15(9-14)27-18-11-19(26-12-25-18)28-16-5-2-6-17(10-16)29-20(30)13-7-8-13/h1-6,9-13H,7-8H2,(H,29,30)(H2,25,26,27,28) |
InChIKey | YOHYSYJDKVYCJI-UHFFFAOYSA-N |
SMILES | C1CC1C(=O)NC2=CC=CC(=C2)NC3=NC=NC(=C3)NC4=CC=CC(=C4)C(F)(F)F |