For research use only. Not for therapeutic Use.
EG1（Cat No.:I026738）is a small-molecule inhibitor designed to target and inhibit the kinesin motor protein Eg5 (also known as KIF11), which is essential for mitotic spindle formation during cell division. By blocking Eg5 activity, EG1 prevents proper bipolar spindle assembly, resulting in mitotic arrest and apoptosis, particularly in rapidly dividing cancer cells. It has been used extensively in cell biology research to study mitotic mechanisms and has potential therapeutic relevance in oncology. EG1’s specificity for Eg5 makes it a valuable tool for investigating mitosis and developing anti-mitotic cancer treatments.
| CAS Number | 693241-54-2 |
| Synonyms | 2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid |
| Molecular Formula | C22H18N2O5 |
| Purity | ≥95% |
| IUPAC Name | 2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid |
| InChI | InChI=1S/C22H18N2O5/c1-29-19-9-5-3-7-17(19)21(26)23-15-12-10-14(11-13-15)20(25)24-18-8-4-2-6-16(18)22(27)28/h2-13H,1H3,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | GYZZRJRJYVMXNS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)NC3=CC=CC=C3C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
