For research use only. Not for therapeutic Use.
Ebaresdax（Cat No.:I026666）is a selective inhibitor of the bromodomain and extraterminal (BET) family proteins, especially targeting BRD2, BRD3, and BRD4. These proteins regulate gene expression through epigenetic control, playing a crucial role in cancer progression, inflammation, and autoimmune disorders. Ebaresdax disrupts BET protein binding to acetylated histones, thereby modulating transcription of oncogenes like MYC. It exhibits strong antitumor activity in preclinical models and holds promise for hematologic malignancies and solid tumors. Its pharmacokinetic properties support both in vitro and in vivo research, enabling exploration of BET inhibition in targeted cancer therapy.
| CAS Number | 1334471-39-4 |
| Synonyms | (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
| Molecular Formula | C12H14N2O3S |
| Purity | ≥95% |
| IUPAC Name | (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
| InChI | InChI=1S/C12H14N2O3S/c1-12(2)9(10(16)17)14-11(18-12)13-7-5-3-4-6-8(7)15/h3-6,9,15H,1-2H3,(H,13,14)(H,16,17)/t9-/m1/s1 |
| InChIKey | OASISJWJIHWVKX-SECBINFHSA-N |
| SMILES | CC1([C@H](N=C(S1)NC2=CC=CC=C2O)C(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
