For research use only. Not for therapeutic Use.
DLin-K-C3-DMA（Cat No.:I045159）is an ionizable cationic lipid widely used in lipid nanoparticle (LNP) formulations for nucleic acid delivery. Its pH-sensitive tertiary amine groups enable efficient mRNA or siRNA encapsulation at acidic conditions and promote endosomal escape after cellular uptake. With a biodegradable backbone and optimized hydrophobic chains, DLin-K-C3-DMA enhances transfection efficiency while reducing toxicity. It plays a key role in advancing mRNA therapeutics, gene editing, and vaccine development, providing a reliable platform for safe, targeted, and effective delivery of genetic cargo in preclinical and clinical research applications.
| CAS Number | 1217306-46-1 |
| Synonyms | 3-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylpropan-1-amine |
| Molecular Formula | C44H81NO2 |
| Purity | ≥95% |
| IUPAC Name | 3-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylpropan-1-amine |
| InChI | InChI=1S/C44H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-44(46-42-43(47-44)38-37-41-45(3)4)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43H,5-12,17-18,23-42H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | HNTKPUXXCNQLFR-KWXKLSQISA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(OC(CO1)CCCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
