For research use only. Not for therapeutic Use.
Diphenhydramine HCl（Cat No.:A000233）is an antihistamine commonly used to treat symptoms of allergy, such as runny nose, sneezing, and itching. It is also widely used as a short-term sleep aid and to prevent motion sickness. Diphenhydramine works by blocking the action of histamine, a substance in the body that causes allergic reactions. Additionally, its sedative properties make it effective in treating insomnia. As a first-generation antihistamine, it can cause drowsiness and other side effects like dry mouth, dizziness, and blurred vision. Prolonged use may lead to tolerance or dependence.
| CAS Number | 147-24-0 |
| Synonyms | NA |
| Molecular Formula | C17H22ClNO |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | 3 years -20C powder |
| IUPAC Name | 2-benzhydryloxy-N,N-dimethylethanamine;hydrochloride |
| InChI | InChI=1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H |
| InChIKey | PCHPORCSPXIHLZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
