For research use only. Not for therapeutic Use.
Dioctanoylglycol（Cat No.:I010219）is a synthetic diester formed by the esterification of glycol with caprylic acid (octanoic acid), known for its emollient and skin-conditioning properties. Commonly used in cosmetic and dermatological formulations, it enhances product texture, provides a smooth, non-greasy feel, and improves skin hydration. Its mildness and compatibility with various ingredients make it ideal for creams, lotions, and personal care products. Additionally, Dioctanoylglycol can act as a solubilizer or carrier for active compounds, supporting their delivery and stability, making it a valuable multifunctional ingredient in skincare and cosmetic applications.
| CAS Number | 627-86-1 |
| Synonyms | 2-octanoyloxyethyl octanoate |
| Molecular Formula | C18H34O4 |
| Purity | ≥95% |
| IUPAC Name | 2-octanoyloxyethyl octanoate |
| InChI | InChI=1S/C18H34O4/c1-3-5-7-9-11-13-17(19)21-15-16-22-18(20)14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| InChIKey | HTNFLUQQANUSLR-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCCOC(=O)CCCCCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
