Dimethyl Sulfoxide (CAT: R024062), commonly known as DMSO, is a versatile organic solvent widely used in various fields. It acts as an excellent solubilizer, dissolving a wide range of organic and inorganic substances. DMSO can penetrate biological membranes, displaying anti-inflammatory and analgesic effects. These properties make it valuable in drug delivery, particularly for topical and transdermal applications. In research laboratories, it serves as a solvent for chemical reactions and a cryoprotectant for proteins and enzymes.
| Catalog Number | R024062 |
| CAS Number | 67-68-5 |
| Synonyms | Sulfinylbismethane; Methyl Sulfoxide; DMS 70; DMS 90; DMSO; DMSO Evol; Demasorb; Demavet; Demeso; Demsodrox; Dimethyl sulfoxide; Dimethyl Sulphoxide; Dimethylsulfoxide; Dimexide; Dimexidum; Dipirartril-tropico; Dolicur; Domoso; Dromisol; Durasorb; Ga |
| Molecular Formula | C2H6OS |
| Purity | 95% |
| Storage | Desiccate at RT |
| IUPAC Name | methylsulfinylmethane |
| InChI | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
| InChIKey | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| SMILES | CS(=O)C |
