For research use only. Not for therapeutic Use.
DIF-3（Cat No.:M023185）is a small molecule known for its role in modulating cellular differentiation and proliferation. It is often used in research related to developmental biology, cancer, and regenerative medicine. By influencing key signaling pathways, DIF-3 can impact stem cell differentiation and tissue repair processes. Its effects on specific gene expression make it a valuable tool for studying various disease models, including those involving abnormal cell growth. Researchers continue to explore its potential in therapeutic applications, particularly in regenerative medicine and cancer treatment.
| CAS Number | 113411-17-9 |
| Synonyms | 1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one |
| Molecular Formula | C13H17ClO4 |
| Purity | ≥95% |
| IUPAC Name | 1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one |
| InChI | InChI=1S/C13H17ClO4/c1-3-4-5-6-8(15)11-9(16)7-10(18-2)12(14)13(11)17/h7,16-17H,3-6H2,1-2H3 |
| InChIKey | JWBMZIJMSBFBIY-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)C1=C(C(=C(C=C1O)OC)Cl)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
