Diethylene glycol monolaurate is an emulsifier and surfactant commonly used in various industries, including cosmetics, food, and pharmaceuticals. It helps stabilize emulsions, preventing the separation of oil and water phases in formulations such as creams, lotions, and food products. With its ability to improve texture and consistency, diethylene glycol monolaurate enhances the overall quality of many consumer goods.
| Catalog Number | R043144 |
| CAS Number | 141-20-8 |
| Synonyms | Dodecanoic Acid 2-(2-Hydroxyethoxy)ethyl Ester;?Lauric Acid 2-(2-Hydroxyethoxy)ethyl Ester; Diethylene Glycol Monolaurate; 2,2’-Dihydroxyethyl Ether Monododecanoate; 2-(2-Hydroxyethoxy)ethyl Dodecanoate; 2-(2-Hydroxyethoxy)ethyl Laurate; Atlas G 2124 |
| Molecular Formula | C16H32O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl dodecanoate |
| InChI | InChI=1S/C16H32O4/c1-2-3-4-5-6-7-8-9-10-11-16(18)20-15-14-19-13-12-17/h17H,2-15H2,1H3 |
| InChIKey | WGIMXKDCVCTHGW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCC(=O)OCCOCCO |
