Didecyl Dimethyl Ammonium Chloride(CAT: R040512) is a synthetic quaternary ammonium compound with disinfectant and surfactant properties. Its mode of action involves being a cationic surfactant that disrupts cell membranes and denatures proteins, leading to the inactivation of bacteria, viruses, and other microorganisms. Pharmacologically, Didecyl Dimethyl Ammonium Chloride is not used as a therapeutic drug on its own. Instead, it is commonly used as an active ingredient in disinfectants, sanitizers, and cleaning products.
Catalog Number | R040512 |
CAS Number | 7173-51-5 |
Synonyms | N-Decyl-N,N-dimethyl-1-decanaminium Chloride; N-Decyl-N,N-dimethyl-1-decanaminium Chloride; Didecyldimethyl-ammonium Chloride; Didecyldimethylammonium Chloride; AQ 210; Acticide DDQ; Acticide DDQ 40; Arquad 10; Arquad 210; Arquad 210-50; Arquad 210- |
Molecular Formula | C22H48ClN |
Purity | 95% |
Storage | Store at -20°C |
IUPAC Name | didecyl(dimethyl)azanium;chloride |
InChI | InChI=1S/C22H48N.ClH/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;/h5-22H2,1-4H3;1H/q+1;/p-1 |
InChIKey | RUPBZQFQVRMKDG-UHFFFAOYSA-M |
SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[Cl-] |