For research use only. Not for therapeutic Use.
DCB(Cat No.:I010478), refers to 3,3′-Dichlorobenzaldazine, also known as 1,2-Bis(3-chlorobenzylidene)hydrazine.in biochemical research, DCB functions as a neutral allosteric modulator of the metabotropic glutamate receptor subtype 5 (mGluR5). It does not directly activate the receptor but can inhibit the effects of other allosteric modulators, such as DFB (3,3′-difluorobenzaldazine) and DMeOB (3,3′-dimethoxybenzaldazine), thereby influencing glutamate signaling pathways .Due to its potential biological activity, DCB is primarily used in neuroscience research to study glutamatergic signaling and receptor modulation.
CAS Number | 6971-97-7 |
Synonyms | (E)-1-(3-chlorophenyl)-N-[(E)-(3-chlorophenyl)methylideneamino]methanimine |
Molecular Formula | C14H10Cl2N2 |
Purity | ≥95% |
IUPAC Name | (E)-1-(3-chlorophenyl)-N-[(E)-(3-chlorophenyl)methylideneamino]methanimine |
InChI | InChI=1S/C14H10Cl2N2/c15-13-5-1-3-11(7-13)9-17-18-10-12-4-2-6-14(16)8-12/h1-10H/b17-9+,18-10+ |
InChIKey | XMOVWXSCYLINBJ-BEQMOXJMSA-N |
SMILES | C1=CC(=CC(=C1)Cl)/C=N/N=C/C2=CC(=CC=C2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |