For research use only. Not for therapeutic Use.
D-Leucine-d10（Cat No.:I043741）is a stable isotope-labeled form of D-leucine, an essential branched-chain amino acid involved in protein synthesis and metabolism. The “d10” indicates that the molecule contains ten deuterium atoms, which are heavier isotopes of hydrogen. This modification makes D-Leucine-d10 valuable in scientific research, particularly in metabolic studies, proteomics, and mass spectrometry. It is often used to trace metabolic pathways, study protein turnover, and analyze amino acid incorporation in biological systems. Additionally, D-Leucine-d10 is employed in synthesizing labeled peptides for structural analysis and functional studies.
| CAS Number | 271247-12-2 |
| Synonyms | (2R)-2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid |
| Molecular Formula | C6H3D10NO2 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1/i1D3,2D3,3D2,4D,5D |
| InChIKey | ROHFNLRQFUQHCH-MSQIRGOSSA-N |
| SMILES | [2H][C@](C(=O)O)(C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
