For research use only. Not for therapeutic Use.
d-Glaucine(Cat No.:R061695)is an isoquinoline alkaloid derived from plants like Glaucium flavum, noted for its bronchodilator, anti-inflammatory, and antitussive properties. Known to inhibit phosphodiesterase and calcium ion channels, d-Glaucine is studied for respiratory conditions, particularly in reducing cough and easing airway constriction. It also exhibits mild psychoactive effects and has been investigated for its impact on dopamine receptors, providing potential for mood and neuropsychiatric research. This natural compound continues to be explored for therapeutic applications, contributing to respiratory, neurological, and anti-inflammatory drug development studies.
| CAS Number | 475-81-0 |
| Synonyms | (6aS)-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinoline; ?(S)-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinoline; 1,2,9,10-Tetramethoxy-6aα-aporphine; Glaucine; (+)-Glaucine; (S)-Glaucine; Boldine |
| Molecular Formula | C21H25NO4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | (6aS)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| InChI | InChI=1S/C21H25NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/t15-/m0/s1 |
| InChIKey | RUZIUYOSRDWYQF-HNNXBMFYSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)OC)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |