For research use only. Not for therapeutic Use.
D-Fructose-d-1(Cat No.:I042806)is a stable isotope-labeled form of D-fructose, a naturally occurring simple sugar found in fruits, honey, and some vegetables. This specific isotope, denoted as “d-1,” refers to the deuterated form of D-fructose, where the hydrogen atom at the first carbon position is replaced with deuterium, a heavier isotope of hydrogen. D-Fructose-d-1 is commonly used in metabolic studies, tracer experiments, and research involving carbohydrate metabolism, helping scientists trace and analyze metabolic pathways and behavior of fructose in living organisms. It plays a key role in biochemical research and pharmaceutical applications.
Synonyms | (3S,4R,5R)-4-deuterio-1,3,4,5,6-pentahydroxyhexan-2-one |
Molecular Formula | C6H11DO6 |
Purity | ≥95% |
IUPAC Name | (3S,4R,5R)-4-deuterio-1,3,4,5,6-pentahydroxyhexan-2-one |
InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1/i5D |
InChIKey | BJHIKXHVCXFQLS-WLJULAHPSA-N |
SMILES | [2H][C@@]([C@@H](CO)O)([C@@H](C(=O)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |