For research use only. Not for therapeutic Use.
D-Friedoolean-14-ene-3β,28-diol (Cat.No:M076511) is a natural triterpenoid compound found in certain plants. It exhibits diverse pharmacological activities and is of interest in medicinal chemistry. With a unique chemical structure, it holds potential for various therapeutic applications, including anti-inflammatory and anticancer properties, as suggested by preclinical studies.
CAS Number | 17884-88-7 |
Molecular Formula | C30H50O2 |
Purity | ≥95% |
Target | Plants |
Storage | -20°C |
IUPAC Name | (3S,4aR,6aR,6aS,8aS,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6a,11,11,14b-heptamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-ol |
InChI | InChI=1S/C30H50O2/c1-25(2)16-17-30(19-31)15-10-22-28(6)12-8-20-26(3,4)24(32)11-14-27(20,5)21(28)9-13-29(22,7)23(30)18-25/h10,20-21,23-24,31-32H,8-9,11-19H2,1-7H3/t20-,21+,23-,24-,27-,28+,29+,30-/m0/s1 |
InChIKey | RJAKLUPHSBOQNU-GCHNNGBASA-N |
SMILES | CC1(CCC2(CC=C3C4(CCC5C(C(CCC5(C4CCC3(C2C1)C)C)O)(C)C)C)CO)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |