For research use only. Not for therapeutic Use.
CP-547632 hydrochloride（Cat No.:I018006）is a potent, selective inhibitor of vascular endothelial growth factor receptor-2 (VEGFR-2/KDR), a critical mediator of angiogenesis. By blocking VEGF-induced receptor phosphorylation and downstream signaling, it suppresses endothelial cell proliferation, migration, and new blood vessel formation. This makes it a valuable research compound for studying tumor angiogenesis, vascular biology, and anti-cancer strategies. CP-547632 hydrochloride has shown strong preclinical efficacy in reducing tumor vascularization and growth, providing insights into VEGFR-2–targeted therapy and its potential role in treating cancer and other angiogenesis-related diseases.
| CAS Number | 252003-71-7 |
| Synonyms | 3-[(4-bromo-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide;hydrochloride |
| Molecular Formula | C20H25BrClF2N5O3S |
| Purity | ≥95% |
| IUPAC Name | 3-[(4-bromo-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide;hydrochloride |
| InChI | InChI=1S/C20H24BrF2N5O3S.ClH/c21-12-9-14(22)13(15(23)10-12)11-31-18-16(17(24)29)19(32-27-18)26-20(30)25-5-1-2-6-28-7-3-4-8-28;/h9-10H,1-8,11H2,(H2,24,29)(H2,25,26,30);1H |
| InChIKey | NNPJZJJMQDXYGN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCCCNC(=O)NC2=C(C(=NS2)OCC3=C(C=C(C=C3F)Br)F)C(=O)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
