For research use only. Not for therapeutic Use.
CM4620(Cat No.:I019966) is a selective inhibitor of calcium release-activated calcium (CRAC) channels, particularly targeting the ORAI1 channel. By inhibiting these channels, CM-4620 reduces calcium influx into cells, thereby modulating calcium-dependent signaling pathways involved in inflammation. This mechanism has been explored in conditions like acute pancreatitis, where excessive calcium influx contributes to disease pathology. Additionally, CM-4620 has been investigated for its potential benefits in treating severe COVID-19 pneumonia, aiming to mitigate infl
| CAS Number | 1713240-67-5 |
| Molecular Formula | C₁₉H₁₁ClF₃N₃O₃ |
| Purity | ≥95% |
| Target | CRAC Channel |
| Storage | Store at -20°C |
| IUPAC Name | N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2-fluoro-6-methylbenzamide |
| InChI | InChI=1S/C19H11ClF3N3O3/c1-9-3-2-4-12(21)17(9)18(27)26-16-8-24-13(7-25-16)10-5-14-15(6-11(10)20)29-19(22,23)28-14/h2-8H,1H3,(H,25,26,27) |
| InChIKey | QQMKTHUGOQDEIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)F)C(=O)NC2=NC=C(N=C2)C3=CC4=C(C=C3Cl)OC(O4)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |