For research use only. Not for therapeutic Use.
CL097（Cat No.:I012711）is a synthetic small-molecule imidazoquinoline compound that acts as a potent agonist of Toll-like receptor 7 (TLR7) and TLR8, key components of the innate immune system. By activating these receptors, CL097 stimulates the production of pro-inflammatory cytokines, type I interferons, and other immune mediators, enhancing both innate and adaptive immune responses. It is widely used in immunological research and vaccine adjuvant development, particularly in cancer immunotherapy and antiviral studies. CL097 helps model immune activation, making it a valuable tool for studying host-pathogen interactions and immune modulation mechanisms.
| CAS Number | 1026249-18-2 |
| Synonyms | 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| Molecular Formula | C13H14N4O |
| Purity | ≥95% |
| IUPAC Name | 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| InChI | InChI=1S/C13H14N4O/c1-2-18-7-10-16-11-8-5-3-4-6-9(8)15-13(14)12(11)17-10/h3-6H,2,7H2,1H3,(H2,14,15)(H,16,17) |
| InChIKey | DEVCLHVFELRPIU-UHFFFAOYSA-N |
| SMILES | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
