For research use only. Not for therapeutic Use.
Cl-NQTrp (Cat No.:I044588) is a synthetic small molecule designed as a potent inhibitor of the bacterial RecA protein, a key player in DNA repair and the SOS response. By targeting RecA, Cl-NQTrp disrupts homologous recombination and DNA damage-induced mutagenesis, sensitizing bacteria to antibiotics and reducing the development of resistance. It shows promise as an adjuvant in antimicrobial therapy, especially in combination with DNA-damaging agents. Cl-NQTrp is valuable for studying bacterial DNA repair mechanisms and for advancing novel approaches to combat antibiotic resistance.
| CAS Number | 185351-23-9 |
| Synonyms | (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-(1H-indol-3-yl)propanoic acid |
| Molecular Formula | C21H15ClN2O4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-(1H-indol-3-yl)propanoic acid |
| InChI | InChI=1S/C21H15ClN2O4/c22-17-18(20(26)14-7-2-1-6-13(14)19(17)25)24-16(21(27)28)9-11-10-23-15-8-4-3-5-12(11)15/h1-8,10,16,23-24H,9H2,(H,27,28)/t16-/m0/s1 |
| InChIKey | ZKNQSBBALRSDBQ-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)Cl)N[C@@H](CC3=CNC4=CC=CC=C43)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
