For research use only. Not for therapeutic Use.
Chloromethyl (Cat No.: R012302) isopropyl carbonate is a reactive organic compound used as an intermediate in pharmaceutical and chemical synthesis. It features a chloromethyl group and an isopropyl carbonate moiety, making it useful for introducing protected hydroxymethyl groups or for forming carbamate and carbonate linkages. The chloro group enables nucleophilic substitution reactions, while the carbonate portion serves as a protecting group for alcohols. This compound is particularly valuable in the development of prodrugs, polymer chemistry, and the preparation of bioactive molecules with tailored properties.
| CAS Number | 35180-01-9 |
| Synonyms | Carbonic Acid Chloromethyl 1-Methylethyl Ester; [(Isopropyloxycarbonyl)oxy]methyl Chloride; |
| Molecular Formula | C5H9ClO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | chloromethyl propan-2-yl carbonate |
| InChI | InChI=1S/C5H9ClO3/c1-4(2)9-5(7)8-3-6/h4H,3H2,1-2H3 |
| InChIKey | JHYNXXBAHWPABC-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)OCCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
