For research use only. Not for therapeutic Use.
Chitin Synthase Inhibitor 4（Cat No.:I043323）is a selective small molecule that targets and inhibits chitin synthase, an enzyme responsible for the biosynthesis of chitin, a crucial component of fungal cell walls and exoskeletons in arthropods. By inhibiting this enzyme, Chitin Synthase Inhibitor 4 disrupts the formation of chitin, weakening the structural integrity of fungal and insect cells. This makes it a promising therapeutic candidate for treating fungal infections and pest infestations. It is being explored for its potential in developing antifungal agents and pest control solutions with fewer side effects compared to traditional treatments.
| CAS Number | 2755847-31-3 |
| Synonyms | 2-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-fluoropyrimidin-4-yl]oxybenzonitrile |
| Molecular Formula | C20H15FN4O |
| Purity | ≥95% |
| IUPAC Name | 2-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-fluoropyrimidin-4-yl]oxybenzonitrile |
| InChI | InChI=1S/C20H15FN4O/c21-18-19(25-11-5-8-14-6-1-3-9-16(14)25)23-13-24-20(18)26-17-10-4-2-7-15(17)12-22/h1-4,6-7,9-10,13H,5,8,11H2 |
| InChIKey | NBUUFZOGDLIBJX-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)C3=C(C(=NC=N3)OC4=CC=CC=C4C#N)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
