For research use only. Not for therapeutic Use.
Cerlapirdine（Cat No.:I005962）is a selective 5-hydroxytryptamine 6 (5-HT6) receptor antagonist developed to enhance cognitive function by modulating neurotransmitter release in brain regions involved in learning and memory. By blocking 5-HT6 receptors, it increases cholinergic, glutamatergic, and dopaminergic signaling, potentially improving cognition in conditions such as Alzheimer’s disease and schizophrenia. Although clinical trials showed mixed efficacy, Cerlapirdine remains valuable in research exploring serotonergic modulation of cognition. Its high selectivity and favorable brain penetration make it an important tool for studying neuropharmacology, memory processes, and potential treatments for cognitive impairment and dementia.
| CAS Number | 925448-93-7 |
| Synonyms | N,N-dimethyl-3-[(3-naphthalen-1-ylsulfonyl-2H-indazol-5-yl)oxy]propan-1-amine |
| Molecular Formula | C22H23N3O3S |
| Purity | ≥95% |
| IUPAC Name | N,N-dimethyl-3-[(3-naphthalen-1-ylsulfonyl-2H-indazol-5-yl)oxy]propan-1-amine |
| InChI | InChI=1S/C22H23N3O3S/c1-25(2)13-6-14-28-17-11-12-20-19(15-17)22(24-23-20)29(26,27)21-10-5-8-16-7-3-4-9-18(16)21/h3-5,7-12,15H,6,13-14H2,1-2H3,(H,23,24) |
| InChIKey | NXQGEDVQXVTCDA-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOC1=CC2=C(NN=C2C=C1)S(=O)(=O)C3=CC=CC4=CC=CC=C43 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
