For research use only. Not for therapeutic Use.
Cefazedone(Cat No.:R047637), is a third-generation cephalosporin antibiotic. It is a semi-synthetic compound derived from cephalosporin C and belongs to the cephalosporin class of antibiotics. Cefazedone has a broad spectrum of activity against both Gram-positive and Gram-negative bacteria. It is used to treat various bacterial infections, including respiratory, urinary tract, skin, and soft tissue infections. As a cephalosporin antibiotic, Cefazedone works by inhibiting bacterial cell wall synthesis, leading to the disruption of bacterial growth and ultimately causing bacterial cell death.
| CAS Number | 56187-47-4 |
| Synonyms | (6R,7R)-7-[[2-(3,5-Dichloro-4-oxo-1(4H)-pyridinyl)acetyl]amino]-3-[[(5-methyl-1,3,4-?thiadiazol-2-yl)thio]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; (6R-trans)-Cefazedone; Refosporen; |
| Molecular Formula | C18H15Cl2N5O5S3 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | 2-8°C |
| IUPAC Name | (6R,7R)-7-[[2-(3,5-dichloro-4-oxopyridin-1-yl)acetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChI | InChI=1S/C18H15Cl2N5O5S3/c1-7-22-23-18(33-7)32-6-8-5-31-16-12(15(28)25(16)13(8)17(29)30)21-11(26)4-24-2-9(19)14(27)10(20)3-24/h2-3,12,16H,4-6H2,1H3,(H,21,26)(H,29,30)/t12-,16-/m1/s1 |
| InChIKey | VTLCNEGVSVJLDN-MLGOLLRUSA-N |
| SMILES | CC1=NN=C(S1)SCC2=C(N3C(C(C3=O)NC(=O)CN4C=C(C(=O)C(=C4)Cl)Cl)SC2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |