For research use only. Not for therapeutic Use.
Carebastine（Cat No.:R009357）is a second-generation, long-acting antihistamine derived from the prodrug ebastine. It acts as a potent and selective H1-receptor antagonist, effectively blocking histamine-mediated responses without significant sedative effects. Carebastine is widely studied for its ability to reduce allergic symptoms such as rhinitis, conjunctivitis, and urticaria. Its favorable pharmacokinetic profile, including once-daily dosing and minimal penetration of the central nervous system, makes it clinically valuable. In research, Carebastine serves as a model compound for exploring allergy management, histamine biology, and antihistamine drug development.
| CAS Number | 90729-42-3 |
| Synonyms | 2-[4-[4-(4-benzhydryloxypiperidin-1-yl)butanoyl]phenyl]-2-methylpropanoic acid |
| Molecular Formula | C32H37NO4 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[4-(4-benzhydryloxypiperidin-1-yl)butanoyl]phenyl]-2-methylpropanoic acid |
| InChI | InChI=1S/C32H37NO4/c1-32(2,31(35)36)27-17-15-24(16-18-27)29(34)14-9-21-33-22-19-28(20-23-33)37-30(25-10-5-3-6-11-25)26-12-7-4-8-13-26/h3-8,10-13,15-18,28,30H,9,14,19-23H2,1-2H3,(H,35,36) |
| InChIKey | XGHOVGYJHWQGCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(=O)CCCN2CCC(CC2)OC(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
