Calcium succinate monohydrate（Cat No.:M069695） is a chemical compound composed of calcium cations (Ca2+) and succinate anions (C4H4O4), with one water molecule bound per unit. It is primarily used in the pharmaceutical industry as a calcium supplement due to its bioavailability and the presence of succinate, which may offer additional health benefits. This compound is also utilized in food additives and dietary supplements. Its synthesis typically involves reacting succinic acid with calcium hydroxide or calcium carbonate in water, followed by crystallization to obtain the monohydrate form. Calcium succinate monohydrate plays a vital role in promoting bone health and overall wellness.
| Catalog Number | M069695 |
| CAS Number | 140-99-8 |
| Molecular Formula | C4H6CaO5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | calcium;butanedioate |
| InChI | InChI=1S/C4H6O4.Ca/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | PBUBJNYXWIDFMU-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(=O)[O-].[Ca+2] |
