For research use only. Not for therapeutic Use.
BSB（Cat No.:I043959）is a water-soluble, homobifunctional crosslinking reagent used primarily in biochemical and molecular biology research. It targets primary amines, such as those on lysine residues, forming stable amide bonds. With a spacer arm of approximately 11.4 Å, BSB enables efficient crosslinking of proteins and peptides in aqueous environments without requiring organic solvents. Its high water solubility and reactivity make it ideal for protein-protein interaction studies, structural biology, and conjugation techniques. BSB’s sulfo-NHS esters enhance cell surface labeling while minimizing membrane permeability, promoting selective extracellular crosslinking.
| CAS Number | 291766-06-8 |
| Synonyms | 5-[(E)-2-[3-bromo-4-[(E)-2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid |
| Molecular Formula | C24H17BrO6 |
| Purity | ≥95% |
| IUPAC Name | 5-[(E)-2-[3-bromo-4-[(E)-2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid |
| InChI | InChI=1S/C24H17BrO6/c25-20-13-16(2-1-14-5-9-21(26)18(11-14)23(28)29)4-8-17(20)7-3-15-6-10-22(27)19(12-15)24(30)31/h1-13,26-27H,(H,28,29)(H,30,31)/b2-1+,7-3+ |
| InChIKey | ZVECSLHUCRIBDY-WMWQKROPSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C2=CC(=C(C=C2)O)C(=O)O)Br)/C=C/C3=CC(=C(C=C3)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
