For research use only. Not for therapeutic Use.
Brr2-IN-3（Cat No.:I028470）is a potent and selective small-molecule inhibitor targeting Brr2, an RNA helicase essential for pre-mRNA splicing. By binding to the ATPase domain of Brr2, it disrupts U4/U6 unwinding, a critical step in spliceosome activation. Brr2-IN-3 offers a valuable research tool for studying spliceosome dynamics, RNA splicing regulation, and associated diseases such as cancer and neurodegeneration. Its specificity allows researchers to explore the therapeutic potential of modulating RNA splicing in disease models, providing insights into novel drug development strategies targeting the splicing machinery. Suitable for in vitro and cellular assays.
| CAS Number | 2104030-82-0 |
| Synonyms | 6-benzyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]-1,4-dihydropyrido[4,3-d]pyrimidine-2,7-dione |
| Molecular Formula | C24H20N4O3S |
| Purity | ≥95% |
| IUPAC Name | 6-benzyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]-1,4-dihydropyrido[4,3-d]pyrimidine-2,7-dione |
| InChI | InChI=1S/C24H20N4O3S/c29-23-10-22-18(13-27(23)12-17-5-2-1-3-6-17)14-28(24(30)26-22)19-7-4-8-20(9-19)31-15-21-11-25-16-32-21/h1-11,13,16H,12,14-15H2,(H,26,30) |
| InChIKey | GAWVULNDIBAUHU-UHFFFAOYSA-N |
| SMILES | C1C2=CN(C(=O)C=C2NC(=O)N1C3=CC(=CC=C3)OCC4=CN=CS4)CC5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
