For research use only. Not for therapeutic Use.
Boc-N-PEG2-MS（Cat No.:I015998）is a heterobifunctional polyethylene glycol derivative featuring a Boc-protected amine at one end and a mesylate (MS) leaving group at the other, connected through a two-unit PEG chain. The Boc group provides temporary protection, allowing selective deprotection and controlled amine conjugation, while the mesylate serves as a reactive handle for nucleophilic substitution. The PEG2 spacer enhances solubility, flexibility, and reduces steric hindrance, ensuring efficient coupling. This versatile reagent is widely applied in peptide synthesis, drug discovery, and bioconjugation for constructing multifunctional biomolecules and advanced therapeutic platforms.
| CAS Number | 302331-20-0 |
| Synonyms | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl methanesulfonate |
| Molecular Formula | C10H21NO6S |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl methanesulfonate |
| InChI | InChI=1S/C10H21NO6S/c1-10(2,3)17-9(12)11-5-6-15-7-8-16-18(4,13)14/h5-8H2,1-4H3,(H,11,12) |
| InChIKey | ZDLSZXWATPDDQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOS(=O)(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
