Bisphenol A-d6 β-D-Glucuronide（Cat No.:R013061） is a high-purity deuterated compound vital for advanced pharmaceutical and toxicological research. This isotopically labeled version of Bisphenol A β-D-Glucuronide, featuring six deuterium atoms, is crucial for studies on endocrine disruption, metabolism, and environmental impact of Bisphenol A. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for metabolic research and environmental studies, Bisphenol A-d6 β-D-Glucuronide integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R013061 |
| CAS Number | 1610029-53-2 |
| Synonyms | 4-[1-(4-Hydroxyphenyl)-1-methylethyl-d6]phenyl β-D-Glucopyranosiduronic Acid; |
| Molecular Formula | C₂₁H₁₈D₆O₈ |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-[1,1,1,3,3,3-hexadeuterio-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChI | InChI=1S/C21H24O8/c1-21(2,11-3-7-13(22)8-4-11)12-5-9-14(10-6-12)28-20-17(25)15(23)16(24)18(29-20)19(26)27/h3-10,15-18,20,22-25H,1-2H3,(H,26,27)/t15-,16-,17+,18-,20+/m0/s1/i1D3,2D3 |
| InChIKey | KHZOXXYQSBJDHB-LZDRGMMYSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)O)(C2=CC=C(C=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)C([2H])([2H])[2H] |
