For research use only. Not for therapeutic Use.
Biliatresone（Cat No.:I015016）is a rare natural isoflavonoid toxin isolated from plants of the Dysphania genus, identified as a causative agent of biliary atresia in animal models. Structurally, it contains an electrophilic α,β-unsaturated ketone moiety, enabling it to form covalent adducts with cellular thiols, leading to oxidative stress and biliary epithelial cell injury. Biliatresone has become an important research tool for studying the pathogenesis of biliary atresia, a severe neonatal liver disease. Its unique mechanism provides insights into bile duct development, redox biology, and potential therapeutic intervention strategies.
| CAS Number | 1801433-90-8 |
| Synonyms | 1-(4,6-dimethoxy-1,3-benzodioxol-5-yl)-2-(2-hydroxyphenyl)prop-2-en-1-one |
| Molecular Formula | C18H16O6 |
| Purity | ≥95% |
| IUPAC Name | 1-(4,6-dimethoxy-1,3-benzodioxol-5-yl)-2-(2-hydroxyphenyl)prop-2-en-1-one |
| InChI | InChI=1S/C18H16O6/c1-10(11-6-4-5-7-12(11)19)16(20)15-13(21-2)8-14-17(18(15)22-3)24-9-23-14/h4-8,19H,1,9H2,2-3H3 |
| InChIKey | SIKIIXNKUAAGAM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)OCO2)OC)C(=O)C(=C)C3=CC=CC=C3O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
