For research use only. Not for therapeutic Use.
(-)-Benzotetramisole（Cat No.:L028853）is a chiral benzyl-substituted imidazole-based compound widely recognized as a powerful enantioselective organocatalyst. It typically appears as a white to off-white crystalline solid and is used in asymmetric synthesis, particularly in acyl transfer reactions such as kinetic resolution of secondary alcohols and esterifications. Its rigid, stereochemically defined structure enables high enantioselectivity and reaction efficiency. (-)-Benzotetramisole is valued in medicinal and synthetic chemistry for facilitating the construction of complex chiral molecules. It is stable under standard conditions and effective at low catalyst loadings, offering excellent reproducibility in stereoselective transformations.
| CAS Number | 950194-37-3 |
| Molecular Formula | C15H12N2S |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-phenyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole |
| InChI | InChI=1S/C15H12N2S/c1-2-6-11(7-3-1)12-10-17-13-8-4-5-9-14(13)18-15(17)16-12/h1-9,12H,10H2/t12-/m1/s1 |
| InChIKey | YGCWPCVAVSIFLO-GFCCVEGCSA-N |
| SMILES | C1[C@@H](N=C2N1C3=CC=CC=C3S2)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
