For research use only. Not for therapeutic Use.
BAY-179（Cat No.:I044005）is a small molecule inhibitor under investigation for its potential in cancer therapy. It targets specific kinases involved in cellular signaling pathways that regulate tumor growth, survival, and metastasis. By inhibiting these key kinases, BAY-179 aims to disrupt cancer cell proliferation and overcome resistance mechanisms associated with conventional treatments. It is being explored for use in various cancers, including solid tumors and hematological malignancies, where its ability to target molecular pathways could offer new therapeutic options and improve treatment outcomes for patients with advanced cancer.
| CAS Number | 2764880-87-5 |
| Synonyms | 4-(1-benzofuran-2-yl)-2-[1-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)piperidin-4-yl]-1,3-thiazole |
| Molecular Formula | C23H21N5OS |
| Purity | ≥95% |
| IUPAC Name | 4-(1-benzofuran-2-yl)-2-[1-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)piperidin-4-yl]-1,3-thiazole |
| InChI | InChI=1S/C23H21N5OS/c1-2-6-19-16(4-1)12-20(29-19)18-14-30-23(26-18)15-7-10-28(11-8-15)13-21-25-17-5-3-9-24-22(17)27-21/h1-6,9,12,14-15H,7-8,10-11,13H2,(H,24,25,27) |
| InChIKey | JOCPQSJABURDDD-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=NC(=CS2)C3=CC4=CC=CC=C4O3)CC5=NC6=C(N5)C=CC=N6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
