For research use only. Not for therapeutic Use.
Basifungin(Cat No.:M107816)is a potent antifungal agent used in medical and pharmaceutical research to combat fungal infections. This compound exhibits strong activity against a broad spectrum of pathogenic fungi, making it invaluable for developing new antifungal therapies. Its unique mechanism of action disrupts fungal cell wall synthesis, ensuring high efficacy and specificity. With high purity and consistent quality, Basifungin is essential for laboratory studies and clinical applications aimed at understanding and treating fungal diseases. It supports the advancement of effective antifungal drugs, contributing significantly to improved healthcare outcomes.
| CAS Number | 127785-64-2 |
| Synonyms | Aureobasidin A;LY 295337; |
| Molecular Formula | C60H92N8O11 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | Store at RT |
| IUPAC Name | (3S,6S,9S,12R,15S,18S,21S,24S,27S)-3,6-dibenzyl-12,24-bis[(2R)-butan-2-yl]-15-(2-hydroxypropan-2-yl)-4,10,16,22-tetramethyl-18-(2-methylpropyl)-9,21-di(propan-2-yl)-13-oxa-1,4,7,10,16,19,22,25-octazabicyclo[25.3.0]triacontane-2,5,8,11,14,17,20,23,26-nonone |
| InChI | InChI=1S/C60H92N8O11/c1-17-38(9)46-57(75)65(14)47(36(5)6)52(70)61-42(32-35(3)4)55(73)67(16)50(60(11,12)78)59(77)79-49(39(10)18-2)58(76)66(15)48(37(7)8)53(71)62-43(33-40-26-21-19-22-27-40)54(72)64(13)45(34-41-28-23-20-24-29-41)56(74)68-31-25-30-44(68)51(69)63-46/h19-24,26-29,35-39,42-50,78H,17-18,25,30-34H2,1-16H3,(H,61,70)(H,62,71)(H,63,69)/t38-,39-,42+,43+,44+,45+,46+,47+,48+,49-,50-/m1/s1 |
| InChIKey | RLMLFADXHJLPSQ-QKCBWMAHSA-N |
| SMILES | CCC(C)C1C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)OC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)C)CC4=CC=CC=C4)C(C)C)C)C(C)CC)C(C)(C)O)C)CC(C)C)C(C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |