For research use only. Not for therapeutic Use.
Azido-PEG4-NHS-ester（Cat No.:I015830）is a versatile heterobifunctional linker widely used in chemical biology and bioconjugation. It features an azide moiety that enables click chemistry reactions, particularly strain-promoted or copper-catalyzed azide–alkyne cycloadditions, allowing site-specific labeling of biomolecules. The PEG4 spacer enhances solubility, reduces steric hindrance, and improves flexibility, ensuring efficient coupling in aqueous or biological systems. The NHS ester reacts selectively with primary amines on proteins, peptides, or other biomolecules, making this reagent highly suitable for applications in targeted drug delivery, protein modification, and advanced diagnostic research.
| CAS Number | 1807534-82-2 |
| Synonyms | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate |
| Molecular Formula | C14H22N4O8 |
| Purity | ≥95% |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetate |
| InChI | InChI=1S/C14H22N4O8/c15-17-16-3-4-22-5-6-23-7-8-24-9-10-25-11-14(21)26-18-12(19)1-2-13(18)20/h1-11H2 |
| InChIKey | GXXUNGLWTNJERF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)COCCOCCOCCOCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
