For research use only. Not for therapeutic Use.
Aurantiamide（Cat No.:R023736）is a naturally occurring dipeptide derivative isolated from fungi and certain medicinal plants. Structurally, it features a cinnamoyl group linked to a dipeptide backbone, contributing to its unique biological activity. Aurantiamide has been reported to exhibit anti-inflammatory, antiviral, antimicrobial, and anticancer properties. It can modulate key signaling pathways, inhibit protease activity, and regulate apoptosis, making it a valuable lead compound in pharmacological studies. As a bioactive natural product, aurantiamide is studied in phytochemistry and drug discovery for its potential therapeutic applications in infectious and inflammatory diseases.
| CAS Number | 58115-31-4 |
| Synonyms | N-[(2S)-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| Molecular Formula | C25H26N2O3 |
| Purity | ≥95% |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| InChI | InChI=1S/C25H26N2O3/c28-18-22(16-19-10-4-1-5-11-19)26-25(30)23(17-20-12-6-2-7-13-20)27-24(29)21-14-8-3-9-15-21/h1-15,22-23,28H,16-18H2,(H,26,30)(H,27,29)/t22-,23-/m0/s1 |
| InChIKey | KSVKECXWDNCRTM-GOTSBHOMSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CO)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
