For research use only. Not for therapeutic Use.
Ascr#5（Cat No:I018346）is a small-molecule ascaroside belonging to the family of nematode-derived signaling metabolites that regulate development, behavior, and social communication. Identified in Caenorhabditis elegans and related species, Ascr#5 plays a key role in dauer formation, lifespan regulation, and inter-organismal signaling. It functions as a pheromone-like cue influencing aggregation, mating, and stress responses, making it a critical tool in neurobiology, developmental biology, and chemical ecology research. As a purified reference standard, Ascr#5 enables studies on nematode signaling pathways, host–parasite interactions, and evolution of chemical communication systems.
| CAS Number | 1086696-26-5 |
| Synonyms | 3-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxypropanoic acid |
| Molecular Formula | C9H16O6 |
| Purity | ≥95% |
| IUPAC Name | 3-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxypropanoic acid |
| InChI | InChI=1S/C9H16O6/c1-5-6(10)4-7(11)9(15-5)14-3-2-8(12)13/h5-7,9-11H,2-4H2,1H3,(H,12,13)/t5-,6+,7+,9+/m0/s1 |
| InChIKey | RYYMJVGKZLQYPG-YYWONIAYSA-N |
| SMILES | C[C@H]1[C@@H](C[C@H]([C@@H](O1)OCCC(=O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
