For research use only. Not for therapeutic Use.
AS1517499(CAT: I005481) is a chemical compound known as a potent inhibitor of STAT6 (Signal Transducer and Activator of Transcription 6). STAT6 is a transcription factor involved in the signaling pathway of certain immune cells, particularly those involved in allergic and inflammatory responses. By inhibiting STAT6, AS1517499 may modulate the activity of these immune cells and potentially impact allergic and inflammatory conditions.
| CAS Number | 919486-40-1 |
| Synonyms | AS-1517499 |
| Molecular Formula | C20H20ClN5O2 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | DMSO: ≥ 35 mg/mL |
| Storage | Desiccate at +4℃ |
| IC50 | 21 nM (STAT6) |
| IUPAC Name | 4-(benzylamino)-2-[2-(3-chloro-4-hydroxyphenyl)ethylamino]pyrimidine-5-carboxamide |
| InChI | InChI=1S/C20H20ClN5O2/c21-16-10-13(6-7-17(16)27)8-9-23-20-25-12-15(18(22)28)19(26-20)24-11-14-4-2-1-3-5-14/h1-7,10,12,27H,8-9,11H2,(H2,22,28)(H2,23,24,25,26) |
| InChIKey | OZRMEKAUZBKTTC-UHFFFAOYSA-N |
| SMILES | c1ccc(cc1)CNc2c(cnc(n2)NCCc3ccc(c(c3)Cl)O)C(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |