For research use only. Not for therapeutic Use.
Anticancer agent 7（Cat No.:I044736）is a synthetic compound developed for its potential to inhibit cancer cell growth and proliferation. While its exact structure may vary depending on the research context, such agents typically target key biological pathways involved in tumor progression, such as cell cycle regulation, apoptosis induction, or angiogenesis inhibition. Anticancer agent 7 may act through mechanisms like kinase inhibition, DNA interaction, or disruption of microtubule dynamics. It is often evaluated in preclinical studies for potency, selectivity, and low toxicity, representing a promising candidate for future chemotherapeutic or targeted cancer therapies.
| CAS Number | 2088956-21-0 |
| Synonyms | N-[(3R,4R,5S)-5-(3,6-dichlorocarbazol-9-yl)-4-hydroxyoxan-3-yl]-4-(trifluoromethoxy)benzenesulfonamide |
| Molecular Formula | C24H19Cl2F3N2O5S |
| Purity | ≥95% |
| IUPAC Name | N-[(3R,4R,5S)-5-(3,6-dichlorocarbazol-9-yl)-4-hydroxyoxan-3-yl]-4-(trifluoromethoxy)benzenesulfonamide |
| InChI | InChI=1S/C24H19Cl2F3N2O5S/c25-13-1-7-20-17(9-13)18-10-14(26)2-8-21(18)31(20)22-12-35-11-19(23(22)32)30-37(33,34)16-5-3-15(4-6-16)36-24(27,28)29/h1-10,19,22-23,30,32H,11-12H2/t19-,22+,23+/m1/s1 |
| InChIKey | XXCAYCBBVUGGDY-OIBXWCBGSA-N |
| SMILES | C1[C@H]([C@@H]([C@H](CO1)N2C3=C(C=C(C=C3)Cl)C4=C2C=CC(=C4)Cl)O)NS(=O)(=O)C5=CC=C(C=C5)OC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
