For research use only. Not for therapeutic Use.
Antibiotic-5d(Cat No.:I002854)is a synthetic antibiotic compound known for its broad-spectrum activity against a variety of bacterial strains, including both Gram-positive and Gram-negative bacteria. Its mechanism of action typically involves inhibition of cell wall synthesis or interference with essential bacterial enzymes, leading to cell death. As a research compound, Antibiotic-5d is valuable in studies focusing on bacterial resistance, novel antibiotic development, and pharmacokinetics. Its stability and effectiveness make it a potential candidate for tackling antibiotic-resistant infections, contributing to innovative approaches in infectious disease research.
| CAS Number | 251349-54-9 |
| Molecular Formula | C13H18N2O4S |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylic acid |
| InChI | InChI=1S/C13H18N2O4S/c1-13(2,3)19-12(18)15-6-4-5-9(15)10-14-8(7-20-10)11(16)17/h7,9H,4-6H2,1-3H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | DPLVJSMBNOUIIM-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C2=NC(=CS2)C(=O)O |
| Reference | <p style=/line-height:25px/> </p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |