For research use only. Not for therapeutic Use.
AMXI-5001（Cat No.:I043995）is a small molecule compound under investigation for its potential pharmacological properties. It is primarily studied for its ability to interact with specific biological targets, which may include enzymes, receptors, or signaling pathways involved in disease progression. Research on AMXI-5001 focuses on its efficacy in modulating cellular processes such as growth, survival, or inflammation, making it a promising candidate for drug development. AMXI-5001 could have potential applications in cancer, autoimmune disorders, or other conditions where targeted intervention is needed to regulate abnormal cellular activity or signaling pathways.
| CAS Number | 2170491-77-5 |
| Synonyms | ethyl N-[6-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl]carbamate |
| Molecular Formula | C25H20FN5O3 |
| Purity | ≥95% |
| IUPAC Name | ethyl N-[6-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl]carbamate |
| InChI | InChI=1S/C25H20FN5O3/c1-2-34-25(33)29-24-27-20-10-8-15(13-22(20)28-24)18-11-14(7-9-19(18)26)12-21-16-5-3-4-6-17(16)23(32)31-30-21/h3-11,13H,2,12H2,1H3,(H,31,32)(H2,27,28,29,33) |
| InChIKey | DCSUGHIXMFUMOQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=NC2=C(N1)C=C(C=C2)C3=C(C=CC(=C3)CC4=NNC(=O)C5=CC=CC=C54)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
