For research use only. Not for therapeutic Use.
AM-095(Cat No.:I000895) represents a significant advancement in the field of G protein-coupled receptor (GPCR) modulation and drug discovery. As a potent antagonist of the lysophosphatidic acid receptor 1 (LPA1), AM-095 demonstrates its effectiveness by inhibiting LPA1 receptor activity. With IC50 values of 0.98 μM for recombinant human LPA1 and 0.73 μM for mouse LPA1, this compound exhibits a strong affinity for the LPA1 receptor. Its ability to selectively target LPA1 receptors makes AM-095 a valuable tool for investigating the physiological roles of LPA signaling and exploring potential therapeutic interventions.
| CAS Number | 1228690-36-5 |
| Synonyms | 2-[4-[4-[3-methyl-4-[[(1R)-1-phenylethoxy]carbonylamino]-1,2-oxazol-5-yl]phenyl]phenyl]acetic acid |
| Molecular Formula | C₂₇H₂₄N₂O₅ |
| Purity | ≥95% |
| Target | LPL Receptor |
| Solubility | DMSO: ≤ 67.3 mg/mL |
| Storage | Store at -20°C |
| IC50 | 0.98/0.73 uM (human/mouse LPA1) |
| IUPAC Name | 2-[4-[4-[3-methyl-4-[[(1R)-1-phenylethoxy]carbonylamino]-1,2-oxazol-5-yl]phenyl]phenyl]acetic acid |
| InChI | InChI=1S/C27H24N2O5/c1-17-25(28-27(32)33-18(2)20-6-4-3-5-7-20)26(34-29-17)23-14-12-22(13-15-23)21-10-8-19(9-11-21)16-24(30)31/h3-15,18H,16H2,1-2H3,(H,28,32)(H,30,31)/t18-/m1/s1 |
| InChIKey | LNDDRUPAICPXIN-GOSISDBHSA-N |
| SMILES | CC1=NOC(=C1NC(=O)O[C@H](C)C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)CC(=O)O |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |