For research use only. Not for therapeutic Use.
Allitol（Cat No.:R041007）is a rare naturally occurring sugar alcohol derived from the monosaccharide allose, classified within the alditol family. As a hexitol, it shares structural similarities with sorbitol and mannitol but possesses unique stereochemistry that influences its biochemical behavior. Allitol has been studied for its potential antioxidant, anti-inflammatory, and immunomodulatory activities, along with possible applications in metabolic regulation. Its rarity and distinct stereochemical profile make it valuable in glycobiology and synthetic carbohydrate chemistry. Emerging interest highlights allitol’s potential roles in pharmaceutical development, functional foods, and biomedical research.
| CAS Number | 488-44-8 |
| Synonyms | (2R,3R,4S,5S)-hexane-1,2,3,4,5,6-hexol |
| Molecular Formula | C6H14O6 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4S,5S)-hexane-1,2,3,4,5,6-hexol |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6+ |
| InChIKey | FBPFZTCFMRRESA-FBXFSONDSA-N |
| SMILES | C([C@H]([C@H]([C@H]([C@H](CO)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
